![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/dvi.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| FALL16/ | 2017-03-14 14:40 | - | |
| FALL17/ | 2017-12-08 19:19 | - | |
| FALL18/ | 2018-12-11 15:17 | - | |
| FALL19/ | 2021-03-29 15:55 | - | |
| FALL20/ | 2020-12-11 15:12 | - | |
| FALL22/ | 2022-11-08 16:54 | - | |
| FALL23/ | 2023-11-18 13:00 | - | |
| FALL24/ | 2024-12-04 15:17 | - | |
| Notes/ | 2024-09-23 10:42 | - | |
| SLIDES/ | 2022-10-10 13:51 | - | |
| SLIDES2/ | 2024-12-04 12:16 | - | |
| SLIDES3/ | 2024-12-04 12:23 | - | |
| SPRING13/ | 2018-12-04 14:48 | - | |
| SPRING15/ | 2016-05-12 11:32 | - | |
| SPRING16/ | 2016-02-08 12:31 | - | |
| SPRING21/ | 2021-02-26 11:28 | - | |
| SPRING22/ | 2022-04-27 12:03 | - | |
| ch2_2024part1.pptx | 2024-09-04 08:15 | 0 | |
| ch2_2024part1a.pptx | 2024-09-04 08:16 | 0 | |
| 7_6ex.log | 2019-12-04 15:45 | 216 | |
| 3_5list.log | 2023-09-28 15:37 | 228 | |
| 3_5listA.log | 2023-09-28 15:39 | 231 | |
| 3_5listB.log | 2023-09-28 15:38 | 231 | |
| 9math | 2013-04-17 10:06 | 249 | |
| 2_7.c | 2016-02-08 13:13 | 380 | |
| 4_3ex1.tex | 2019-10-23 12:16 | 435 | |
| 1_2hint.html | 2019-08-25 23:18 | 561 | |
| handouts.html | 2017-05-02 13:37 | 586 | |
| 5_5.log | 2018-10-05 12:27 | 591 | |
| prereq.html | 2017-08-20 21:52 | 627 | |
| linearEqn.log | 2017-09-29 18:42 | 769 | |
| TF2.html | 2016-04-11 16:35 | 884 | |
| ch6and7handoutsOLD100.html | 2019-10-25 11:48 | 896 | |
| 2_4examples.tex | 2017-09-08 16:05 | 1.0K | |
| 6_3help.tex | 2016-04-12 19:38 | 1.1K | |
| link.html | 2013-01-25 14:08 | 1.1K | |
| week11b.html | 2013-04-10 10:17 | 1.1K | |
| 4_1Abel.tex | 2019-10-23 12:16 | 1.1K | |
| week15c.html | 2013-05-10 10:07 | 1.2K | |
| week6.html | 2017-10-02 15:13 | 1.3K | |
| week7a.html | 2013-03-06 10:02 | 1.3K | |
| TF3.html | 2016-04-11 16:37 | 1.3K | |
| week9c.html | 2019-11-15 15:45 | 1.4K | |
| week5a.html | 2019-11-15 15:55 | 1.4K | |
| week2TFe4.html | 2016-09-02 14:08 | 1.4K | |
| 2_8n.log | 2017-09-13 13:41 | 1.5K | |
| 7_6complexPolar.tex | 2016-04-11 10:33 | 1.5K | |
| 6_1and2.tex | 2016-10-24 11:14 | 1.5K | |
| 6_2simplify.tex | 2023-10-23 12:04 | 1.6K | |
| week10b.html | 2013-04-03 18:06 | 1.6K | |
| week5.html | 2016-02-24 13:16 | 1.6K | |
| ch6and7handouts.html | 2019-11-01 12:20 | 1.6K | |
| ch6and7handouts1.html | 2019-11-01 17:05 | 1.6K | |
| we.html | 2013-04-03 23:20 | 1.7K | |
| 6_2simplify.log | 2023-10-23 12:04 | 1.7K | |
| 2_4examples.log | 2017-09-08 16:05 | 1.7K | |
| laPlace_table_notes.tex | 2024-10-30 13:12 | 1.7K | |
| week10_20.html | 2017-10-27 16:00 | 1.7K | |
| week2TF.html | 2019-09-11 12:05 | 1.8K | |
| 5_4.log | 2018-10-17 13:52 | 1.9K | |
| week8.html | 2013-03-15 09:41 | 1.9K | |
| week8aaa.html | 2017-10-11 16:17 | 1.9K | |
| 2_8.tex | 2016-02-12 12:15 | 1.9K | |
| week6a.html | 2017-10-02 15:15 | 1.9K | |
| week9a.html | 2019-11-15 15:44 | 1.9K | |
| 3_3.tex | 2013-02-22 12:02 | 2.0K | |
| 6_3.tex | 2016-10-26 13:50 | 2.0K | |
| 2_3ex.tex | 2016-08-31 13:58 | 2.0K | |
| week9aANS.html | 2013-03-25 09:51 | 2.0K | |
| 7_6complex.tex | 2016-04-06 12:48 | 2.1K | |
| partialfrac.log | 2017-08-20 22:03 | 2.1K | |
| partialfrac.tex | 2017-08-20 21:52 | 2.2K | |
| week11aANS.html | 2019-11-15 15:43 | 2.2K | |
| 5_1.tex | 2013-03-04 12:08 | 2.2K | |
| week11a.html | 2019-11-15 15:42 | 2.2K | |
| week9c.html] | 2013-03-28 14:31 | 2.3K | |
| week9b.html | 2019-11-15 15:45 | 2.3K | |
| e2review.tex | 2016-04-18 12:09 | 2.4K | |
| 7_5exrr.tex | 2024-12-02 12:38 | 2.4K | |
| week9cANS.html | 2013-03-28 15:00 | 2.4K | |
| week9bANS.html | 2013-03-27 09:51 | 2.4K | |
| ch5graphs.tex | 2018-11-10 13:21 | 2.4K | |
| week5ANS.html | 2017-09-19 16:58 | 2.4K | |
| ch9a.log | 2019-12-13 09:44 | 2.5K | |
| 7_6.tex | 2013-04-15 23:56 | 2.5K | |
| quiz4_2018.tex | 2018-11-10 13:21 | 2.5K | |
| 3_2.log | 2017-09-20 14:59 | 2.6K | |
| 7_5graphingNEW.log | 2023-11-29 08:20 | 2.6K | |
| week15.html | 2017-12-04 15:25 | 2.7K | |
| 3_5list.synctex.gz | 2023-09-28 15:37 | 2.7K | |
| 3_5listB.synctex.gz | 2023-09-28 15:38 | 2.7K | |
| grapht-eps-converted-to.pdf | 2018-11-12 12:41 | 2.8K | |
| ch9.log | 2019-12-04 11:48 | 2.8K | |
| week10a.html | 2013-04-01 09:52 | 2.8K | |
| week10aANS.html | 2013-04-01 09:55 | 2.9K | |
| ch9bw.log | 2019-12-13 09:56 | 2.9K | |
| quiz4_2018ans.tex | 2018-11-10 13:21 | 2.9K | |
| 3_8trig.log | 2019-10-14 14:15 | 2.9K | |
| 2_4examples.synctex.gz | 2017-09-08 16:05 | 2.9K | |
| 3_2a.tex | 2013-02-23 18:47 | 3.0K | |
| 7_6ex.tex | 2019-12-04 15:45 | 3.1K | |
| 5_5.txt | 2013-03-29 11:56 | 3.1K | |
| 7_5exrrLargeGraphs.log | 2024-12-02 13:01 | 3.3K | |
| dfieldpracticeANSa.log | 2018-11-29 15:07 | 3.4K | |
| 7_8.log | 2019-12-11 12:03 | 3.4K | |
| 7theory.tex | 2013-04-05 11:54 | 3.4K | |
| laPlace_table_notes.log | 2024-10-30 13:12 | 3.5K | |
| 4_4.tex | 2019-10-23 12:16 | 3.6K | |
| onetooneINV.txt | 2013-01-22 23:49 | 3.7K | |
| 5_1.dvi | 2013-03-24 12:14 | 3.7K | |
| oldcourses.html | 2020-09-28 20:09 | 3.8K | |
| onetoone_151a.txt | 2013-01-22 23:47 | 3.8K | |
| onetooneONTO_151.txt | 2013-01-22 23:48 | 3.9K | |
| 7_5exrrLargeGraphs.tex | 2024-12-02 13:01 | 4.0K | |
| 6_3new.tex | 2016-12-11 14:32 | 4.0K | |
| ch9.tex | 2019-12-04 11:47 | 4.1K | |
| ch9bw.tex | 2019-12-13 09:55 | 4.1K | |
| 3_5exA.tex | 2017-10-02 14:11 | 4.1K | |
| 6_3new17.tex | 2017-10-29 14:58 | 4.2K | |
| 2_4n.tex | 2016-01-29 12:46 | 4.3K | |
| 2_4.tex | 2016-09-02 13:39 | 4.3K | |
| hypConcl.tex | 2016-01-29 12:21 | 4.4K | |
| ch9a.tex | 2019-12-13 09:44 | 4.4K | |
| 3_5ex.tex | 2016-02-29 11:34 | 4.4K | |
| 7_7tis0.log | 2019-12-09 11:09 | 4.4K | |
| 7_7new.log | 2019-12-09 11:37 | 4.5K | |
| 5_5.tex | 2013-03-29 12:10 | 4.5K | |
| 6_2simplify.synctex.gz | 2023-10-23 12:04 | 4.6K | |
| quiz3.tex | 2013-04-17 09:48 | 4.7K | |
| TFmath4answers.html | 2016-11-28 11:44 | 4.8K | |
| linearEqn.tex | 2017-09-29 18:42 | 4.9K | |
| dfieldpractice.tex | 2018-11-23 20:19 | 4.9K | |
| ch9a.synctex.gz | 2019-12-13 09:44 | 4.9K | |
| 3_5listA.synctex.gz | 2023-09-28 15:39 | 4.9K | |
| laPlace_table_notes.synctex.gz | 2024-10-30 13:12 | 5.0K | |
| ch9.synctex.gz | 2019-12-04 11:48 | 5.0K | |
| TFmath4.html | 2016-11-28 11:42 | 5.0K | |
| ch9bw.synctex.gz | 2019-12-13 09:56 | 5.0K | |
| ch5graphs1.log | 2018-11-12 13:10 | 5.4K | |
| 3_8appl.tex | 2017-10-11 15:42 | 5.5K | |
| 2_8n.tex | 2017-09-13 13:41 | 5.5K | |
| 3_6.tex | 2017-10-06 15:34 | 5.5K | |
| 3.9.tex | 2016-10-17 14:01 | 5.9K | |
| quiz2Fall2019Empty.tex | 2019-09-21 14:30 | 6.0K | |
| reviewMidterm2.html | 2017-10-27 15:39 | 6.1K | |
| linear.html | 2022-03-19 21:17 | 6.2K | |
| 4_3ex1.pdf | 2019-10-23 12:16 | 6.2K | |
| 2_8new.tex | 2019-09-11 14:09 | 6.3K | |
| 5_5.dvi | 2013-03-29 12:10 | 6.6K | |
| 7_5ex.log | 2024-11-20 15:03 | 6.6K | |
| 6_3newANS.tex | 2016-12-11 14:32 | 6.6K | |
| 3_8trig.tex | 2019-10-14 14:15 | 6.7K | |
| exam1review.tex | 2017-09-22 15:30 | 6.9K | |
| PartialFractions.html | 2023-08-30 12:26 | 7.0K | |
| nonlinearSystem.png | 2016-11-16 13:18 | 7.2K | |
| 4_1unity.tex | 2017-10-16 14:57 | 7.3K | |
| 3_5listSans.tex | 2017-10-06 15:34 | 7.4K | |
| dfieldpracticeANSa.tex | 2018-11-29 15:07 | 7.6K | |
| dfieldpracticeANSold.tex | 2018-11-23 20:19 | 7.6K | |
| ch5graphs1.tex | 2018-11-12 13:10 | 7.6K | |
| 9_3.tex | 2016-11-16 13:23 | 7.6K | |
| 5_3a.tex | 2016-03-21 12:33 | 7.9K | |
| 3_6and4_4varPar.tex | 2017-10-18 16:04 | 8.0K | |
| 2_5a.tex | 2016-02-08 13:13 | 8.1K | |
| 7_7tis0.tex | 2019-12-09 11:09 | 8.6K | |
| 7_7new.tex | 2019-12-09 11:37 | 8.6K | |
| 7_7.tex | 2016-12-11 14:35 | 8.8K | |
| 3_5list.pdf | 2023-09-28 15:37 | 8.9K | |
| 3_5listB.pdf | 2023-09-28 15:38 | 8.9K | |
| reviewMidterm2new.html | 2017-10-29 14:58 | 9.8K | |
| ch3new.log | 2018-09-21 11:52 | 9.9K | |
| 4_1.tex | 2013-03-25 09:53 | 11K | |
| 7_8.tex | 2019-12-11 12:03 | 11K | |
| 6_2simplify.pdf | 2023-10-23 12:04 | 11K | |
| homework2b_new.html | 2023-08-30 12:17 | 12K | |
| 7_5graphingNEW.tex | 2023-11-29 08:20 | 12K | |
| reviewMidterm2_2019.html | 2019-10-24 14:08 | 12K | |
| 3_5listA.pdf | 2023-09-28 15:39 | 12K | |
| 5_4.tex | 2018-10-17 13:52 | 12K | |
| 5_4.dvi | 2013-03-25 10:11 | 12K | |
| 3_5listS.pdf | 2017-10-06 15:34 | 12K | |
| List of Chapters and Sections.docx | 2023-09-01 12:02 | 12K | |
| mv.html | 2022-10-06 13:48 | 13K | |
| 5_5part2.tex | 2013-04-24 10:18 | 13K | |
| 5_2.tex | 2013-03-11 10:03 | 13K | |
| ch5graphs.pdf | 2018-11-10 13:21 | 13K | |
| 2_4examples.pdf | 2017-09-08 16:05 | 13K | |
| 7_5exrrLargeGraphs.synctex.gz | 2024-12-02 13:01 | 13K | |
| 5_5.synctex.gz | 2018-10-05 12:27 | 13K | |
| 7_6ex.synctex.gz | 2019-12-04 15:45 | 14K | |
| 7_5exrr.pdf | 2024-12-02 08:24 | 14K | |
| 3_5listA.tex | 2023-09-28 15:39 | 14K | |
| onetooneONTO_151.pdf | 2013-01-22 23:48 | 14K | |
| TFold.html | 2016-04-12 19:55 | 14K | |
| 4_1Abel.pdf | 2019-10-23 12:16 | 14K | |
| 3_5listS.tex | 2017-10-06 15:34 | 14K | |
| TFanswersold.html | 2016-11-28 11:46 | 15K | |
| TF.html | 2019-11-13 12:14 | 15K | |
| 3_5.tex | 2017-09-18 14:06 | 15K | |
| 3_5list.tex | 2023-09-28 15:37 | 15K | |
| 3_5listB.tex | 2023-09-28 15:38 | 15K | |
| 6_3help.pdf | 2016-04-12 19:34 | 15K | |
| 3_7and8transientVSss.tex | 2019-10-16 12:01 | 15K | |
| 17.gif | 2018-11-23 20:20 | 15K | |
| quiz4_2018.pdf | 2018-11-10 13:21 | 15K | |
| TFanswers.html | 2019-11-13 12:14 | 15K | |
| hypConcl.pdf | 2016-01-29 12:21 | 15K | |
| onetoone_151a.pdf | 2013-01-22 23:47 | 15K | |
| 7_5.tex | 2016-11-16 14:03 | 16K | |
| 4_1.dvi | 2013-03-25 09:57 | 16K | |
| 3_5exA.pdf | 2017-10-02 14:11 | 17K | |
| ch7and9.tex | 2017-11-17 15:19 | 17K | |
| ch1and2a.tex | 2017-09-22 15:30 | 17K | |
| 4_1unity.log | 2017-10-16 14:57 | 18K | |
| 4_1unity.synctex.gz | 2017-10-16 14:57 | 18K | |
| slopefieldnsIVP.pdf | 2017-09-08 15:26 | 18K | |
| Figure2_8.png | 2017-09-13 19:22 | 19K | |
| 7_6complex.pdf | 2016-04-06 12:48 | 19K | |
| ch5graphs1.synctex.gz | 2018-11-12 13:10 | 19K | |
| ch5graphs1.pdf | 2018-11-12 13:10 | 19K | |
| 3600v.html | 2018-11-10 13:22 | 20K | |
| ch4.tex | 2017-10-18 16:03 | 20K | |
| 4_1unity.pdf | 2017-10-16 14:57 | 20K | |
| 7_5exrrLargeGraphs.pdf | 2024-12-02 13:01 | 20K | |
| linearEqn.pdf | 2017-09-29 18:42 | 20K | |
| 3_8trig.synctex.gz | 2019-10-14 14:15 | 20K | |
| dfieldpracticeANSa.synctex.gz | 2018-11-29 15:07 | 20K | |
| 7_6ex.pdf | 2019-12-04 15:45 | 20K | |
| 4_4.pdf | 2019-10-23 12:16 | 21K | |
| 7_6complexPolar.pdf | 2016-04-11 16:22 | 21K | |
| dfield2cuberoot.pdf | 2018-08-31 13:55 | 21K | |
| 5_5part2.dvi | 2013-04-01 13:11 | 21K | |
| e2review.pdf | 2016-04-18 12:09 | 21K | |
| 2_8n.synctex.gz | 2017-09-13 13:41 | 21K | |
| 2_8.pdf | 2016-02-12 12:15 | 21K | |
| 7_5graphingNEW.pdf | 2023-11-29 08:20 | 22K | |
| 3_5exEM4.pdf | 2016-02-29 11:29 | 22K | |
| 6_3new17.pdf | 2017-10-29 14:58 | 22K | |
| linearEqn.synctex.gz | 2017-09-29 18:42 | 22K | |
| 3_5listSans.pdf | 2017-10-06 15:34 | 22K | |
| 3_2.tex | 2017-09-20 14:59 | 23K | |
| 6_3.pdf | 2016-10-26 13:50 | 23K | |
| dy=y13.docx | 2016-01-20 13:05 | 23K | |
| dy=y13_3600.docx | 2016-01-20 13:06 | 23K | |
| 23pq.pdf | 2018-11-29 15:15 | 24K | |
| 3_5ex.pdf | 2016-02-29 11:34 | 24K | |
| 5_4.synctex.gz | 2018-10-17 13:52 | 25K | |
| 2299_001.pdf | 2013-04-25 15:53 | 25K | |
| 5_5.pdf | 2018-10-05 12:27 | 25K | |
| LaPlace.pdf | 2017-10-25 15:51 | 26K | |
| ch3.tex | 2016-09-18 21:12 | 26K | |
| onetooneINV.pdf | 2013-01-22 23:49 | 26K | |
| domain.gif | 2017-09-08 15:28 | 26K | |
| 3_6.pdf | 2017-10-06 15:37 | 27K | |
| 21pq.pdf | 2018-11-29 14:53 | 27K | |
| 6_3new.pdf | 2016-12-11 14:32 | 27K | |
| 23q.pdf | 2018-11-29 15:00 | 27K | |
| slopefieldIVPnosoln.gif | 2017-09-08 15:27 | 28K | |
| 7_5graphingNEW.synctex.gz | 2023-11-29 08:20 | 29K | |
| ch3_134.tex | 2017-09-18 14:06 | 29K | |
| 3.9.pdf | 2016-10-17 14:01 | 29K | |
| 22pq.pdf | 2018-11-29 14:53 | 29K | |
| 2_7.gif | 2016-02-08 13:13 | 29K | |
| 6_3newANS.pdf | 2016-12-11 14:32 | 30K | |
| 3_5.pdf | 2017-09-18 14:06 | 30K | |
| 7theorys.pdf | 2013-04-05 11:55 | 30K | |
| 2_8n.pdf | 2017-09-13 13:41 | 30K | |
| 3_2.synctex.gz | 2017-09-20 14:59 | 31K | |
| 2_4n.pdf | 2016-01-29 12:46 | 31K | |
| LaPlaceTable.pdf | 2024-10-30 13:09 | 32K | |
| 2_4.pdf | 2016-09-02 13:42 | 32K | |
| ch3new.tex | 2018-09-21 11:52 | 32K | |
| 3_2.pdf | 2017-09-20 14:59 | 33K | |
| 5_5s.pdf | 2013-03-29 12:11 | 34K | |
| 22q.pdf | 2018-11-29 14:58 | 34K | |
| 18.gif | 2018-11-23 20:20 | 34K | |
| population.png | 2016-08-23 21:34 | 34K | |
| gravity.png | 2016-08-23 21:34 | 34K | |
| laPlace_table_notes.pdf | 2024-10-30 13:12 | 35K | |
| 3_8trig.pdf | 2019-10-14 14:15 | 35K | |
| Figure2_7.png | 2017-09-13 19:22 | 35K | |
| 3_6and4_4varPar.pdf | 2017-10-18 15:45 | 35K | |
| quiz4em4answers.pdf | 2016-04-08 15:58 | 35K | |
| 7_5graphing.pdf | 2023-11-27 07:54 | 36K | |
| ch3_134.pdf | 2017-09-18 14:06 | 36K | |
| 6_3news.pdf | 2016-12-11 14:32 | 36K | |
| 5_4.pdf | 2018-10-17 13:52 | 37K | |
| 7_5ex.pdf | 2024-11-20 15:03 | 38K | |
| 7_8.pdf | 2019-12-11 12:03 | 38K | |
| 3_7and8transientVSss.pdf | 2019-10-16 10:54 | 40K | |
| 2_4ns.pdf | 2016-01-29 15:38 | 40K | |
| LaPlaceTable6_2.pdf | 2017-10-29 14:58 | 40K | |
| 7_7tis0.synctex.gz | 2019-12-09 11:09 | 40K | |
| 7_7new.synctex.gz | 2019-12-09 11:37 | 40K | |
| quiz3DFieldFormA.pdf | 2019-09-21 14:30 | 41K | |
| 300px-Phase_plane_nodes.svg.png | 2018-11-10 13:21 | 41K | |
| 6_3newANSs.pdf | 2016-12-11 14:32 | 41K | |
| Phase-portraits-for-a-system-of-linear-first-order-differential-equations.png | 2018-11-10 13:21 | 42K | |
| 2_7ex_dy=y_2.docx | 2016-09-14 14:05 | 43K | |
| 3_8appl.pdf | 2017-10-11 15:47 | 43K | |
| Phase_plane_nodes.svg | 2019-12-12 17:16 | 43K | |
| ch4.pdf | 2017-10-18 15:43 | 43K | |
| 7_8.synctex.gz | 2019-12-11 12:03 | 45K | |
| 4_1s.pdf | 2013-03-25 09:57 | 45K | |
| ch7and9.pdf | 2017-11-17 15:19 | 45K | |
| 7_5ex.tex | 2024-11-20 15:03 | 45K | |
| domainf_y.pdf | 2016-02-08 13:13 | 46K | |
| 9_3.pdf | 2016-11-16 13:23 | 46K | |
| 5_3as.pdf | 2013-03-24 12:13 | 46K | |
| 2_7.pdf | 2016-02-08 13:13 | 48K | |
| 5_4s.pdf.pdf | 2013-03-25 10:12 | 48K | |
| domainf_t.pdf | 2016-02-08 13:13 | 49K | |
| 5_4s.pdf | 2013-03-25 10:13 | 50K | |
| 3_2s.pdf | 2017-09-20 15:33 | 50K | |
| fig2_7.pdf | 2019-09-11 14:09 | 50K | |
| 7_5.pdf | 2016-11-16 14:03 | 52K | |
| domain72.pdf | 2016-02-08 13:13 | 52K | |
| quiz2Fall2019Empty.pdf | 2019-09-21 14:29 | 53K | |
| ch3_134s.pdf | 2017-09-20 15:35 | 55K | |
| 9_3s.Lpdf.pdf | 2016-11-16 13:51 | 55K | |
| 9_3s.pdf | 2016-11-16 13:46 | 55K | |
| 2_7ex_dy=y_2.pdf | 2016-09-14 14:05 | 56K | |
| quiz4_2018ans.pdf | 2018-11-10 13:21 | 58K | |
| quiz3.pdf | 2013-04-17 09:48 | 61K | |
| 5_2s.pdf | 2013-03-24 12:19 | 63K | |
| 6_1and2.pdf | 2016-10-24 11:14 | 63K | |
| 22ba.pdf | 2018-11-29 15:07 | 63K | |
| 7_5ex.synctex.gz | 2024-11-20 15:03 | 63K | |
| ch3.pdf | 2016-09-18 21:12 | 63K | |
| 3_3.pdf | 2013-02-22 12:02 | 64K | |
| 18.pdf | 2018-11-23 20:20 | 64K | |
| ch3new18sections1-4.pdf | 2019-09-21 14:29 | 64K | |
| LaPlace.html | 2024-10-30 13:16 | 65K | |
| ch3new.pdf | 2018-09-21 11:52 | 66K | |
| 5_2.pdf | 2013-03-11 10:04 | 66K | |
| fundMatrixWA(1).pdf | 2016-12-11 14:36 | 67K | |
| fundMatrixWA.pdf | 2016-12-11 14:36 | 67K | |
| Untitled-1.nb | 2013-04-17 10:07 | 68K | |
| dfield2cuberoot.mw | 2018-08-31 15:56 | 74K | |
| ch3new18.pdf | 2018-09-24 09:54 | 77K | |
| 3_2a.pdf | 2013-02-23 18:49 | 78K | |
| 21q.pdf | 2018-11-29 15:01 | 78K | |
| DE_DiracDeltaFunction.pdf | 2017-11-08 15:31 | 79K | |
| 7_7s.pdf | 2016-12-11 14:35 | 80K | |
| 2_7n.pdf | 2017-09-08 16:11 | 81K | |
| partialfrac.pdf | 2017-08-20 22:03 | 84K | |
| 7_6.pdf | 2013-04-15 23:56 | 87K | |
| Phase_plane_nodes1.JPG | 2019-12-12 17:21 | 89K | |
| 2_3ex.pdf | 2016-08-31 13:58 | 90K | |
| 7_7tis0.pdf | 2019-12-09 11:09 | 93K | |
| 7_7new.pdf | 2019-12-09 11:37 | 93K | |
| ch3s.pdf | 2016-09-18 21:11 | 93K | |
| fig2_7.pptx | 2019-09-11 14:09 | 95K | |
| domain.jpg | 2017-09-08 15:28 | 95K | |
| slope field - Wolfram_AlphaSc.pdf | 2016-02-10 12:15 | 96K | |
| 7theory.pdf | 2013-04-05 10:12 | 96K | |
| slope field - Wolfram_Alpha.pdf | 2016-02-10 11:39 | 96K | |
| ch3newS.pdf | 2018-09-21 11:44 | 96K | |
| ch3new.synctex.gz | 2018-09-21 11:52 | 97K | |
| slopefieldIVPnosoln.jpg | 2017-09-08 15:27 | 98K | |
| 7_7.pdf | 2016-12-11 14:35 | 98K | |
| ch9bw.pdf | 2019-12-13 09:56 | 98K | |
| ch9.pdf | 2019-12-04 11:48 | 98K | |
| 5_1.pdf | 2013-03-04 12:08 | 99K | |
| 5_5part2.pdf | 2013-04-24 10:18 | 112K | |
| Phase_plane_nodes1.PNG | 2019-12-12 17:21 | 119K | |
| slopefields.mw | 2016-11-11 17:34 | 119K | |
| slopefieldWolfram_Ay1_3.pdf | 2018-08-31 13:37 | 121K | |
| slopefieldWolfram_Ay1_3wrong.pdf | 2018-08-31 13:50 | 122K | |
| 2_8approximation.pdf | 2020-09-14 13:13 | 124K | |
| 8_1slopeReview1.pdf | 2016-09-12 14:10 | 124K | |
| 2_5a.pdf | 2016-02-08 13:13 | 126K | |
| 5_3a.pdf | 2016-03-21 12:33 | 127K | |
| 2_7and8.mw | 2017-09-13 19:21 | 129K | |
| 2_4and5ode.pdf | 2016-02-08 16:02 | 131K | |
| 2+8and8.mw | 2017-09-13 16:15 | 134K | |
| fig2_7.png | 2019-09-11 14:09 | 139K | |
| slopefieldWolfram_Ay1_3wronga.pdf | 2018-08-31 15:55 | 146K | |
| ch9aa.pdf | 2019-12-13 09:45 | 147K | |
| ch9nonlinear.pdf | 2016-04-15 12:49 | 155K | |
| exam1reviewS.pdf | 2017-09-22 15:40 | 157K | |
| slopefieldsWA.pdf | 2016-08-23 21:34 | 167K | |
| dy=y13.pdf | 2016-08-23 21:34 | 168K | |
| 3_5Banswers.pdf | 2023-09-29 11:35 | 175K | |
| 22.PNG | 2018-11-23 20:20 | 187K | |
| 2_8new.pdf | 2019-09-11 14:10 | 188K | |
| 21a.PNG | 2018-11-23 20:20 | 188K | |
| 22a.PNG | 2018-11-23 20:20 | 192K | |
| 22b.PNG | 2018-11-23 20:20 | 194K | |
| 21.PNG | 2018-11-23 20:20 | 195K | |
| slopefieldWolfram_Alphay1_3.pdf | 2018-08-31 12:29 | 196K | |
| 2_7and8andCh5.mw | 2018-11-28 13:51 | 198K | |
| 22c.PNG | 2018-11-23 20:20 | 198K | |
| 23.PNG | 2018-11-23 20:20 | 199K | |
| slopefieldmcANS.pdf | 2013-02-25 15:43 | 210K | |
| 18_11_09.pdf | 2018-11-10 13:21 | 230K | |
| ch9a.pdf | 2019-12-13 09:44 | 234K | |
| mainBuchananSingula.pdf | 2016-12-05 17:37 | 236K | |
| dfield2ex1.mw | 2018-09-28 11:29 | 266K | |
| ch1and2aS.pdf | 2017-09-22 15:43 | 276K | |
| dfieldpracticeANS.pdf | 2018-11-29 15:09 | 284K | |
| 2_4thmss.pdf | 2019-09-11 15:31 | 306K | |
| dfield2.mw | 2018-08-31 13:42 | 320K | |
| ch5maple.pdf | 2018-11-28 13:46 | 329K | |
| 19.PNG | 2018-11-23 20:20 | 332K | |
| 20.PNG | 2018-11-23 20:20 | 343K | |
| 18.PNG | 2018-11-23 20:20 | 346K | |
| 17.PNG | 2018-11-23 20:20 | 347K | |
| 7_6notes2019.pdf | 2019-12-02 09:15 | 416K | |
| slopefieldsWA.docx | 2016-08-23 21:34 | 441K | |
| exam1review.pdf | 2017-09-22 15:30 | 453K | |
| exam1review2018.pdf | 2018-09-24 09:54 | 505K | |
| ch1and2a.pdf | 2017-09-22 15:30 | 511K | |
| CH02_2a.pdf | 2016-01-20 11:26 | 522K | |
| TangleEquations.pdf | 2019-09-13 10:45 | 553K | |
| ch9_2016.pdf | 2016-04-13 12:24 | 587K | |
| approxSoln2_8andCh5.pdf | 2018-11-28 13:58 | 589K | |
| Engineer Math IV_ Differential Equations.pdf | 2017-11-15 18:25 | 841K | |
| ch9nonlinearPracticeQuiz.mw | 2018-11-29 15:17 | 942K | |
| 7_5graphingNOTES.pdf | 2023-11-27 13:41 | 1.0M | |
| CH02_2aL.pdf | 2016-08-23 21:34 | 1.1M | |
| pictures2.mw | 2018-09-28 11:29 | 1.2M | |
| pictures.mw | 2016-12-05 17:37 | 1.2M | |
| dfieldpracticeANSa.pdf | 2018-11-29 15:07 | 1.5M | |
| ch9nonlinear.mw | 2016-04-15 16:00 | 1.8M | |
| ch03.ppt | 2019-10-25 11:48 | 1.8M | |
| dfieldpractice.pdf | 2018-11-23 20:19 | 1.8M | |
| dfieldpracticeANSold.pdf | 2018-11-23 20:20 | 1.8M | |
| ch9_2019.mw | 2019-12-11 11:38 | 2.0M | |
| ch9_2016.mw | 2018-11-07 15:42 | 2.0M | |
| ch9_3nonlinear.pdf | 2018-11-26 14:11 | 2.1M | |
| mvreview.pptx | 2022-04-08 21:05 | 2.3M | |
| ch2_2024part1aaaa.pptx | 2024-09-04 08:13 | 2.4M | |
| ch9_3nonlinear.mw | 2018-11-26 15:46 | 3.4M | |
| 1_1and2_3Applications_Fall2023.pptx | 2023-08-18 13:55 | 3.8M | |